Online Database of Chemicals from Around the World
|
CAS#: 42255-14-1 Product: 3-Hydroxynonachlorodiphenyl Ether No suppilers available for the product. |
| Name | 3-Hydroxynonachlorodiphenyl Ether |
|---|---|
| Synonyms | 2,3,4,5,6,2',3',4',6'-Nonachlorodiphenyl Ether; 2,3,4,6-Tetrachloro-5-(Pentachlorophenoxy)Phen*; 2,3,4,6-Tetrachloro-5-(Pentachlorophenoxy)Phenol |
| Molecular Structure |  |
| Molecular Formula | C12HCl9O2 |
| Molecular Weight | 496.22 |
| CAS Registry Number | 42255-14-1 |
| SMILES | C1(=C(C(=C(C(=C1Cl)O)Cl)Cl)Cl)OC2=C(C(=C(C(=C2Cl)Cl)Cl)Cl)Cl |
| InChI | 1S/C12HCl9O2/c13-1-2(14)6(18)11(7(19)3(1)15)23-12-8(20)4(16)5(17)10(22)9(12)21/h22H |
| InChIKey | GFTSIDLUOSZZIW-UHFFFAOYSA-N |
| Density | 1.865g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.813°C at 760 mmHg (Cal.) |
| Flash point | 225.839°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Hydroxynonachlorodiphenyl Ether |