| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Buten-2-Yl 2-Oxopropanoate |
|---|---|
| Synonyms | but-3-en-2-yl 2-oxopropanoate; InChI=1/C7H10O3/c1-4-5(2)10-7(9)6(3)8/h4-5H,1H2,2-3H3 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 |
| CAS Registry Number | 423157-74-8 |
| SMILES | CC(C=C)OC(=O)C(=O)C |
| InChI | 1S/C7H10O3/c1-4-5(2)10-7(9)6(3)8/h4-5H,1H2,2-3H3 |
| InChIKey | ZFUQHIBURURUNI-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 180.3±19.0°C at 760 mmHg (Cal.) |
| Flash point | 65.6±18.7°C (Cal.) |
| Refractive index | 1.427 (Cal.) |
| (1) | Frances Heaney, Julie Fenlon, Colm O'Mahony, Patrick McArdle and Desmond Cunningham. Nitrogen-containing heterocycles: 1,3-dipolar cycloaddition of stabilized nitrones with alkynes; primary cycloadducts, first and second generation rearrangement processes, J. Chem. Soc., Perkin Trans. 1, 2001, 0, 3382. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-Buten-2-Yl 2-Oxopropanoate |