Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| MP Biomedicals LLC. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (440) 337-1200 | |||
|
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Name | 2-Iodobenzylamine Hydrochloride |
|---|---|
| Synonyms | (2-Iodobenzyl)Amine Hydrochloride; O-Iodobenzylamine Hydrochloride |
| Molecular Structure |  |
| Molecular Formula | C7H9ClIN |
| Molecular Weight | 269.51 |
| CAS Registry Number | 42365-45-7 |
| EINECS | 255-777-0 |
| SMILES | [H+].C1=C(CN)C(=CC=C1)I.[Cl-] |
| InChI | 1S/C7H8IN.ClH/c8-7-4-2-1-3-6(7)5-9;/h1-4H,5,9H2;1H |
| InChIKey | GAEPVUMSCPGMFX-UHFFFAOYSA-N |
| Boiling point | 270°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 117.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Iodobenzylamine Hydrochloride |