Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
|
+41 (24) 466-2929 | |||
|
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 2-(1-Phenylethyl)Phenol |
|---|---|
| Synonyms | Nsc1769; Phenol, 2-(1-Phenylethyl)-; Phenol, O-(.Alpha.-Methylbenzyl)- |
| Molecular Structure |  |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.26 |
| CAS Registry Number | 4237-44-9 |
| EINECS | 224-198-5 |
| SMILES | C1=C(C(=CC=C1)O)C(C)C2=CC=CC=C2 |
| InChI | 1S/C14H14O/c1-11(12-7-3-2-4-8-12)13-9-5-6-10-14(13)15/h2-11,15H,1H3 |
| InChIKey | WYZIVNCBUWDCOZ-UHFFFAOYSA-N |
| Density | 1.074g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.895°C at 760 mmHg (Cal.) |
| Flash point | 148.484°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(1-Phenylethyl)Phenol |