Online Database of Chemicals from Around the World
|
CAS#: 42434-89-9 Product: 7-Bromo-3-Phenylbenzofuran No suppilers available for the product. |
| Name | 7-Bromo-3-Phenylbenzofuran |
|---|---|
| Synonyms | 7-Bromo-3-Phenyl-Benzofuran; 7-Bromo-3-Phenylbenzofuran |
| Molecular Structure |  |
| Molecular Formula | C14H9BrO |
| Molecular Weight | 273.13 |
| CAS Registry Number | 42434-89-9 |
| EINECS | 255-821-9 |
| SMILES | C2=C(C1=C(C(=CC=C1)Br)O2)C3=CC=CC=C3 |
| InChI | 1S/C14H9BrO/c15-13-8-4-7-11-12(9-16-14(11)13)10-5-2-1-3-6-10/h1-9H |
| InChIKey | PCPFVKJXSNDOBF-UHFFFAOYSA-N |
| Density | 1.454g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.896°C at 760 mmHg (Cal.) |
| Flash point | 181.741°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Bromo-3-Phenylbenzofuran |