Online Database of Chemicals from Around the World
|
CAS#: 42461-89-2 Product: 5-(3-Bromo-1-Propenyl)-1,3-Benzodioxole No suppilers available for the product. |
| Name | 5-(3-Bromo-1-Propenyl)-1,3-Benzodioxole |
|---|---|
| Synonyms | 1,3-Benzodioxole, 5-(3-Bromo-1-Propenyl)-; 3'-Bromoisosafrole; Brn 1310620 |
| Molecular Structure |  |
| Molecular Formula | C10H9BrO2 |
| Molecular Weight | 241.08 |
| CAS Registry Number | 42461-89-2 |
| SMILES | C1=C(C=CC2=C1OCO2)\C=C\CBr |
| InChI | 1S/C10H9BrO2/c11-5-1-2-8-3-4-9-10(6-8)13-7-12-9/h1-4,6H,5,7H2/b2-1+ |
| InChIKey | SXLQGBDEYDVFKV-OWOJBTEDSA-N |
| Density | 1.558g/cm3 (Cal.) |
|---|---|
| Boiling point | 311.042°C at 760 mmHg (Cal.) |
| Flash point | 143.918°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(3-Bromo-1-Propenyl)-1,3-Benzodioxole |