Online Database of Chemicals from Around the World
|
CAS#: 42482-68-8 Product: (18alpha,19alpha)-Urs-20-Ene-3,16-Dione No suppilers available for the product. |
| Name | (18alpha,19alpha)-Urs-20-Ene-3,16-Dione |
|---|---|
| Synonyms | 4,4,6A,6B,8A,11,12,14B-Octamethyl-2,4A,5,6,6A,7,9,12,12A,13,14,14A-Dodecahydro-1H-Picene-3,8-Quinone; Urs-20-Ene-3,16-Dione; Urs-20-Ene-3,16-Dione, (18.Alpha.)- |
| Molecular Structure |  |
| Molecular Formula | C30H46O2 |
| Molecular Weight | 438.69 |
| CAS Registry Number | 42482-68-8 |
| SMILES | CC1(C(CCC3(C1CCC4(C)C2(CC(=O)C5(C(C2CCC34)C(C)C(=CC5)C)C)C)C)=O)C |
| InChI | 1S/C30H46O2/c1-18-11-14-28(6)24(32)17-30(8)20(25(28)19(18)2)9-10-22-27(5)15-13-23(31)26(3,4)21(27)12-16-29(22,30)7/h11,19-22,25H,9-10,12-17H2,1-8H3 |
| InChIKey | JZDSIQGHBJTPKJ-UHFFFAOYSA-N |
| Density | 1.006g/cm3 (Cal.) |
|---|---|
| Boiling point | 514.404°C at 760 mmHg (Cal.) |
| Flash point | 189.784°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (18alpha,19alpha)-Urs-20-Ene-3,16-Dione |