Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2-Methyl-4,6-Di(4-Pyridinyl)-1,3,5-Triazine |
|---|---|
| Synonyms | 2,4-DI-(4-PYRIDYL)-6-METHYL-S-TRIAZINE |
| Molecular Structure |  |
| Molecular Formula | C14H11N5 |
| Molecular Weight | 249.27 |
| CAS Registry Number | 42518-09-2 |
| SMILES | Cc1nc(nc(n1)c2ccncc2)c3ccncc3 |
| InChI | 1S/C14H11N5/c1-10-17-13(11-2-6-15-7-3-11)19-14(18-10)12-4-8-16-9-5-12/h2-9H,1H3 |
| InChIKey | BOABUEIOMFJXKA-UHFFFAOYSA-N |
| Density | 1.232g/cm3 (Cal.) |
|---|---|
| Boiling point | 542.415°C at 760 mmHg (Cal.) |
| Flash point | 258.832°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-4,6-Di(4-Pyridinyl)-1,3,5-Triazine |