Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Mellitic Trianhydride |
|---|---|
| Synonyms | Mellitic Trianhydride; Nsc80679 |
| Molecular Structure |  |
| Molecular Formula | C12O9 |
| Molecular Weight | 288.13 |
| CAS Registry Number | 4253-24-1 |
| SMILES | O=C1OC(=O)C2=C4C(=C3C(=C12)C(OC3=O)=O)C(OC4=O)=O |
| InChI | 1S/C12O9/c13-7-1-2(8(14)19-7)4-6(12(18)21-11(4)17)5-3(1)9(15)20-10(5)16 |
| InChIKey | NNYHMCFMPHPHOQ-UHFFFAOYSA-N |
| Density | 2.237g/cm3 (Cal.) |
|---|---|
| Boiling point | 756.739°C at 760 mmHg (Cal.) |
| Flash point | 339.134°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Mellitic Trianhydride |