Online Database of Chemicals from Around the World
|
CAS#: 42533-63-1 Product: 1-(Bromomethyl)-2-Chloro-4-Nitrobenzene No suppilers available for the product. |
| Name | 1-(Bromomethyl)-2-Chloro-4-Nitrobenzene |
|---|---|
| Synonyms | 1-(Bromomethyl)-2-Chloro-4-Nitro-Benzene |
| Molecular Structure |  |
| Molecular Formula | C7H5BrClNO2 |
| Molecular Weight | 250.48 |
| CAS Registry Number | 42533-63-1 |
| EINECS | 255-874-8 |
| SMILES | C1=C([N+]([O-])=O)C=CC(=C1Cl)CBr |
| InChI | 1S/C7H5BrClNO2/c8-4-5-1-2-6(10(11)12)3-7(5)9/h1-3H,4H2 |
| InChIKey | MBLOVZIAFQVXIN-UHFFFAOYSA-N |
| Density | 1.755g/cm3 (Cal.) |
|---|---|
| Boiling point | 322.791°C at 760 mmHg (Cal.) |
| Flash point | 149.019°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Bromomethyl)-2-Chloro-4-Nitrobenzene |