|
CAS#: 42537-96-2 Product: Cbz-Leu-Ile-OH No suppilers available for the product. |
| Name | Cbz-Leu-Ile-OH |
|---|---|
| Synonyms | (2S,3S)-3-Methyl-2-[[(2S)-4-Methyl-1-Oxo-2-[[Oxo-(Phenylmethoxy)Methyl]Amino]Pentyl]Amino]Pentanoic Acid; (2S,3S)-2-[[(2S)-2-(Benzyloxycarbonylamino)-4-Methyl-Pentanoyl]Amino]-3-Methyl-Valeric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 |
| CAS Registry Number | 42537-96-2 |
| EINECS | 255-875-3 |
| SMILES | [C@@H](NC([C@@H](NC(=O)OCC1=CC=CC=C1)CC(C)C)=O)(C(=O)O)[C@H](CC)C |
| InChI | 1S/C20H30N2O5/c1-5-14(4)17(19(24)25)22-18(23)16(11-13(2)3)21-20(26)27-12-15-9-7-6-8-10-15/h6-10,13-14,16-17H,5,11-12H2,1-4H3,(H,21,26)(H,22,23)(H,24,25)/t14-,16-,17-/m0/s1 |
| InChIKey | VFBACQGDAHTASH-XIRDDKMYSA-N |
| Density | 1.131g/cm3 (Cal.) |
|---|---|
| Boiling point | 598.022°C at 760 mmHg (Cal.) |
| Flash point | 315.473°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cbz-Leu-Ile-OH |