Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Glycyl-beta-Alanyl-Glycine |
|---|---|
| Synonyms | H-GLY-β-ALA-GLY-OH; ZINC02561009 |
| Molecular Structure |  |
| Molecular Formula | C7H13N3O4 |
| Molecular Weight | 203.20 |
| CAS Registry Number | 42538-54-5 |
| SMILES | [O-]C(=O)CNC(=O)CCNC(=O)C[NH3+] |
| InChI | 1S/C7H13N3O4/c8-3-6(12)9-2-1-5(11)10-4-7(13)14/h1-4,8H2,(H,9,12)(H,10,11)(H,13,14) |
| InChIKey | YYFOFHHIXIEANM-UHFFFAOYSA-N |
| Density | 1.317g/cm3 (Cal.) |
|---|---|
| Boiling point | 633.254°C at 760 mmHg (Cal.) |
| Flash point | 336.78°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Glycyl-beta-Alanyl-Glycine |