Online Database of Chemicals from Around the World
|
CAS#: 42571-84-6 Product: 5-Isopropyl-3-Methylphenyl Chloroformate No suppilers available for the product. |
| Name | 5-Isopropyl-3-Methylphenyl Chloroformate |
|---|---|
| Synonyms | (3-Isopropyl-5-Methyl-Phenyl) Chloroformate; Chloroformic Acid (3-Isopropyl-5-Methylphenyl) Ester; Chloroformic Acid (3-Isopropyl-5-Methyl-Phenyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C11H13ClO2 |
| Molecular Weight | 212.68 |
| CAS Registry Number | 42571-84-6 |
| EINECS | 255-890-5 |
| SMILES | C1=C(C(C)C)C=C(C=C1OC(Cl)=O)C |
| InChI | 1S/C11H13ClO2/c1-7(2)9-4-8(3)5-10(6-9)14-11(12)13/h4-7H,1-3H3 |
| InChIKey | BBPDRHBZXDFJBM-UHFFFAOYSA-N |
| Density | 1.129g/cm3 (Cal.) |
|---|---|
| Boiling point | 257.772°C at 760 mmHg (Cal.) |
| Flash point | 98.132°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Isopropyl-3-Methylphenyl Chloroformate |