Online Database of Chemicals from Around the World
|
CAS#: 426-50-6 Product: Trichloro(1,1,2,3,3,3-Hexafluoropropyl)Silane No suppilers available for the product. |
| Name | Trichloro(1,1,2,3,3,3-Hexafluoropropyl)Silane |
|---|---|
| Synonyms | 2-Hydrohexafluoropropyltrichlorosilane; Silane, Trichloro(1,1,2,3,3,3-Hexafluoropropyl)- |
| Molecular Structure |  |
| Molecular Formula | C3HCl3F6Si |
| Molecular Weight | 285.48 |
| CAS Registry Number | 426-50-6 |
| EINECS | 207-042-0 |
| SMILES | C(C([Si](Cl)(Cl)Cl)(F)F)(F)C(F)(F)F |
| InChI | 1S/C3HCl3F6Si/c4-13(5,6)3(11,12)1(7)2(8,9)10/h1H |
| InChIKey | RQPZGJMUMIAPLX-UHFFFAOYSA-N |
| Density | 1.576g/cm3 (Cal.) |
|---|---|
| Boiling point | 67.371°C at 760 mmHg (Cal.) |
| Flash point | -5.454°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trichloro(1,1,2,3,3,3-Hexafluoropropyl)Silane |