Online Database of Chemicals from Around the World
|
CAS#: 4261-17-0 Product: 2,4-Diamino-6-Pteridinecarboxaldehyde No suppilers available for the product. |
| Name | 2,4-Diamino-6-Pteridinecarboxaldehyde |
|---|---|
| Synonyms | 2,4-Diamino-6-Pteridinecarboxaldehyde; 6-Pteridinecarboxaldehyde, 2,4-Diamino-; Daptca |
| Molecular Structure |  |
| Molecular Formula | C7H6N6O |
| Molecular Weight | 190.16 |
| CAS Registry Number | 4261-17-0 |
| SMILES | C2=NC1=NC(=NC(=C1N=C2C=O)N)N |
| InChI | 1S/C7H6N6O/c8-5-4-6(13-7(9)12-5)10-1-3(2-14)11-4/h1-2H,(H4,8,9,10,12,13) |
| InChIKey | QBSIXCBKOMWSBZ-UHFFFAOYSA-N |
| Density | 1.688g/cm3 (Cal.) |
|---|---|
| Boiling point | 584.087°C at 760 mmHg (Cal.) |
| Flash point | 307.045°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Diamino-6-Pteridinecarboxaldehyde |