Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Methyl Bromo(2-Nitrophenyl)Acetate |
|---|---|
| Synonyms | 2-Bromo-2-(2-nitrophenyl)acetic acid methyl ester; methyl 2-bromo-2-(2-nitrophenyl)acetate; methyl-2-bromo-2-(2-nitrophenyl)acetate |
| Molecular Formula | C9H8BrNO4 |
| Molecular Weight | 274.07 |
| CAS Registry Number | 42794-41-2 |
| SMILES | O=C(OC)C(Br)c1ccccc1[N+]([O-])=O |
| InChI | 1S/C9H8BrNO4/c1-15-9(12)8(10)6-4-2-3-5-7(6)11(13)14/h2-5,8H,1H3 |
| InChIKey | ALNXYSMZZZSIHH-UHFFFAOYSA-N |
| Density | 1.631g/cm3 (Cal.) |
|---|---|
| Boiling point | 356.806°C at 760 mmHg (Cal.) |
| Flash point | 169.59°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl Bromo(2-Nitrophenyl)Acetate |