Online Database of Chemicals from Around the World
|
CAS#: 42935-25-1 Product: 4-Aminophenyl Fucoside No suppilers available for the product. |
| Name | 4-Aminophenyl Fucoside |
|---|---|
| Synonyms | (2S,3S,4R,5S,6S)-2-(4-Aminophenoxy)-6-Methyl-Tetrahydropyran-3,4,5-Triol; (2S,3S,4R,5S,6S)-2-(4-Aminophenoxy)-6-Methyltetrahydropyran-3,4,5-Triol; (2S,3S,4R,5S,6S)-2-(4-Aminophenoxy)-6-Methyl-Oxane-3,4,5-Triol |
| Molecular Structure |  |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 |
| CAS Registry Number | 42935-25-1 |
| SMILES | [C@H]2(OC1=CC=C(C=C1)N)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O2)C |
| InChI | 1S/C12H17NO5/c1-6-9(14)10(15)11(16)12(17-6)18-8-4-2-7(13)3-5-8/h2-6,9-12,14-16H,13H2,1H3/t6-,9+,10+,11-,12-/m0/s1 |
| InChIKey | CITVZWPAGDTXQI-SQKFTNEHSA-N |
| Density | 1.416g/cm3 (Cal.) |
|---|---|
| Boiling point | 488.501°C at 760 mmHg (Cal.) |
| Flash point | 249.236°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Aminophenyl Fucoside |