Online Database of Chemicals from Around the World
|
CAS#: 4302-92-5 Product: N,alpha-Dimethyl-2-Nitrobenzeneethanamine No suppilers available for the product. |
| Name | N,alpha-Dimethyl-2-Nitrobenzeneethanamine |
|---|---|
| Synonyms | Methyl-[1-Methyl-2-(2-Nitrophenyl)Ethyl]Amine; Brn 2724928; Benzeneethanamine, N,Alpha-Dimethyl-2-Nitro- (9Ci) |
| Molecular Structure |  |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 |
| CAS Registry Number | 4302-92-5 |
| SMILES | C1=CC=CC(=C1CC(NC)C)[N+]([O-])=O |
| InChI | 1S/C10H14N2O2/c1-8(11-2)7-9-5-3-4-6-10(9)12(13)14/h3-6,8,11H,7H2,1-2H3 |
| InChIKey | GPGIHKMMXVEDQK-UHFFFAOYSA-N |
| Density | 1.102g/cm3 (Cal.) |
|---|---|
| Boiling point | 288.45°C at 760 mmHg (Cal.) |
| Flash point | 128.25°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,alpha-Dimethyl-2-Nitrobenzeneethanamine |