Online Database of Chemicals from Around the World
|
CAS#: 43027-41-4 Product: 2-Chloromethyl-1,4-Naphthoquinone No suppilers available for the product. |
| Name | 2-Chloromethyl-1,4-Naphthoquinone |
|---|---|
| Synonyms | 2-(Chloromethyl)-1,4-Naphthoquinone; 2-Chloromethyl-1,4-Naphthoquinone; 2-Clch2-1,4-Naphthoquinone |
| Molecular Structure |  |
| Molecular Formula | C11H7ClO2 |
| Molecular Weight | 206.63 |
| CAS Registry Number | 43027-41-4 |
| SMILES | C1=CC=CC2=C1C(=O)C(=CC2=O)CCl |
| InChI | 1S/C11H7ClO2/c12-6-7-5-10(13)8-3-1-2-4-9(8)11(7)14/h1-5H,6H2 |
| InChIKey | WMWNDBUOCWAJAL-UHFFFAOYSA-N |
| Density | 1.351g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.016°C at 760 mmHg (Cal.) |
| Flash point | 143.017°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloromethyl-1,4-Naphthoquinone |