Online Database of Chemicals from Around the World
|
CAS#: 43057-68-7 Product: 2-Ethyl-2,3-Dihydro-2-Methyl-1H-Perimidine No suppilers available for the product. |
| Name | 2-Ethyl-2,3-Dihydro-2-Methyl-1H-Perimidine |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.29 |
| CAS Registry Number | 43057-68-7 |
| SMILES | C1=CC=C2C=CC=C3NC(NC1=C23)(C)CC |
| InChI | 1S/C14H16N2/c1-3-14(2)15-11-8-4-6-10-7-5-9-12(16-14)13(10)11/h4-9,15-16H,3H2,1-2H3 |
| InChIKey | QOYINWMUFFDLBI-UHFFFAOYSA-N |
| Density | 1.058g/cm3 (Cal.) |
|---|---|
| Boiling point | 402.434°C at 760 mmHg (Cal.) |
| Flash point | 262.875°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ethyl-2,3-Dihydro-2-Methyl-1H-Perimidine |