Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
|
+44 (845) 299-6009/ | |||
|
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 2-[(6-Hydroxy-3-Biphenylyl)Carbonyl]Benzoic Acid |
|---|---|
| Synonyms | 2-((6-hydroxy(1,1'-biphenyl)-3-yl)carbonyl)benzoic acid; 2-(6-HYDROXY-BIPHENYL-3-CARBONYL)-BENZOIC ACID; 2-[(4-hydroxy-3-phenylphenyl)carbonyl]benzoic acid |
| Molecular Structure | ![CAS#: 432106-71-3， 2-[(6-Hydroxy-3-Biphenylyl)Carbonyl]Benzoic Acid](/moreStructures/432106-71-3.gif) |
| Molecular Formula | C20H14O4 |
| Molecular Weight | 318.32 |
| CAS Registry Number | 432106-71-3 |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC(=C2)C(=O)C3=CC=CC=C3C(=O)O)O |
| InChI | 1S/C20H14O4/c21-18-11-10-14(12-17(18)13-6-2-1-3-7-13)19(22)15-8-4-5-9-16(15)20(23)24/h1-12,21H,(H,23,24) |
| InChIKey | PKHPZNKXOBWFCX-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 593.9±50.0°C at 760 mmHg (Cal.) |
| Flash point | 327.0±26.6°C (Cal.) |
| Refractive index | 1.655 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(6-Hydroxy-3-Biphenylyl)Carbonyl]Benzoic Acid |