Online Database of Chemicals from Around the World
|
CAS#: 4335-05-1 Product: N,N,beta,beta-Tetramethyl-10H-Phenothiazine-10-Propan-1-Amine No suppilers available for the product. |
| Name | N,N,beta,beta-Tetramethyl-10H-Phenothiazine-10-Propan-1-Amine |
|---|---|
| Synonyms | N,N,2,2-Tetramethyl-3-Phenothiazin-10-Yl-Propan-1-Amine; N,N,2,2-Tetramethyl-3-(10-Phenothiazinyl)Propan-1-Amine; (2,2-Dimethyl-3-Phenothiazin-10-Yl-Propyl)-Dimethyl-Amine |
| Molecular Structure |  |
| Molecular Formula | C19H24N2S |
| Molecular Weight | 312.47 |
| CAS Registry Number | 4335-05-1 |
| SMILES | C1=CC=CC2=C1N(CC(CN(C)C)(C)C)C3=C(S2)C=CC=C3 |
| InChI | 1S/C19H24N2S/c1-19(2,13-20(3)4)14-21-15-9-5-7-11-17(15)22-18-12-8-6-10-16(18)21/h5-12H,13-14H2,1-4H3 |
| InChIKey | KYNBTEGMZBRGSV-UHFFFAOYSA-N |
| Density | 1.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 428.255°C at 760 mmHg (Cal.) |
| Flash point | 212.801°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N,beta,beta-Tetramethyl-10H-Phenothiazine-10-Propan-1-Amine |