| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | N-Desmethylatomoxetine |
|---|---|
| Synonyms | (3R)-3-(2-methylphenoxy)-3-phenylpropan-1-amine |
| Molecular Structure | ![]() |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 |
| CAS Registry Number | 435293-68-8 |
| SMILES | CC1=CC=CC=C1O[C@H](CCN)C2=CC=CC=C2 |
| Solubility | 163.3 mg/L (25 °C water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.573, Calc.* |
| Melting point | 112.52 °C |
| Boiling Point | 352.89 °C, 379.2±37.0 °C (760 mmHg), Calc.* |
| Flash Point | 181.3±19.8 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for N-Desmethylatomoxetine |