Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2-[(2-Bromophenyl)Amino]Benzoic Acid |
|---|---|
| Synonyms | 2-(2-Bromoanilino)benzoic acid; 2-(2-Bromoanilino)benzoic acid #; 2'-Bromodiphenylamine-2-carboxylic acid |
| Molecular Structure | ![CAS#: 4357-60-2， 2-[(2-Bromophenyl)Amino]Benzoic Acid](/moreStructures/4357-60-2.gif) |
| Molecular Formula | C13H10BrNO2 |
| Molecular Weight | 292.13 |
| CAS Registry Number | 4357-60-2 |
| SMILES | Brc2ccccc2Nc1ccccc1C(=O)O |
| InChI | 1S/C13H10BrNO2/c14-10-6-2-4-8-12(10)15-11-7-3-1-5-9(11)13(16)17/h1-8,15H,(H,16,17) |
| InChIKey | KPCDVSVFXNGOGR-UHFFFAOYSA-N |
| Density | 1.586g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.243°C at 760 mmHg (Cal.) |
| Flash point | 198.884°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(2-Bromophenyl)Amino]Benzoic Acid |