Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Furan-2-Ylmethyl-(4-Methyl-Benzyl)-Amine |
|---|---|
| Synonyms | 2-Furylmethyl-[(4-Methylphenyl)Methyl]Ammonium; 2-Furylmethyl-(4-Methylbenzyl)Ammonium; Zinc00300135 |
| Molecular Structure |  |
| Molecular Formula | C13H16NO |
| Molecular Weight | 202.28 |
| CAS Registry Number | 436099-83-1 |
| SMILES | C1=C(OC=C1)C[NH2+]CC2=CC=C(C=C2)C |
| InChI | 1S/C13H15NO/c1-11-4-6-12(7-5-11)9-14-10-13-3-2-8-15-13/h2-8,14H,9-10H2,1H3/p+1 |
| InChIKey | LTKSRIGURQCUJV-UHFFFAOYSA-O |
| Boiling point | 296.258°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 132.972°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Furan-2-Ylmethyl-(4-Methyl-Benzyl)-Amine |