Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3,4-Dicyanobenzoyl Chloride |
|---|---|
| Synonyms | 3,4-dicyanobenzoyl chloride |
| Molecular Structure |  |
| Molecular Formula | C9H3ClN2O |
| Molecular Weight | 190.59 |
| CAS Registry Number | 437552-35-7 |
| SMILES | c1cc(c(cc1C(=O)Cl)C#N)C#N |
| InChI | 1S/C9H3ClN2O/c10-9(13)6-1-2-7(4-11)8(3-6)5-12/h1-3H |
| InChIKey | FUQQNZDXUMWAJP-UHFFFAOYSA-N |
| Density | 1.413g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.59°C at 760 mmHg (Cal.) |
| Flash point | 187.603°C (Cal.) |
| Refractive index | 1.589 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dicyanobenzoyl Chloride |