|
CAS#: 4388-82-3 Product: Barbexaclone No suppilers available for the product. |
| Name | Barbexaclone |
|---|---|
| Synonyms | (2S)-1-Cyclohexyl-N-Methyl-Propan-2-Amine; 5-Ethyl-5-Phenyl-Hexahydropyrimidine-2,4,6-Trione; (2S)-1-Cyclohexyl-N-Methylpropan-2-Amine; 5-Ethyl-5-Phenylhexahydropyrimidine-2,4,6-Trione; [(1S)-2-Cyclohexyl-1-Methyl-Ethyl]-Methyl-Amine; 5-Ethyl-5-Phenyl-Barbituric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 |
| CAS Registry Number | 4388-82-3 |
| EINECS | 224-504-7 |
| SMILES | [C@@H](NC)(CC1CCCCC1)C.C3=C(C2(C(=O)NC(=O)NC2=O)CC)C=CC=C3 |
| InChI | 1S/C12H12N2O3.C10H21N/c1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16;1-9(11-2)8-10-6-4-3-5-7-10/h3-7H,2H2,1H3,(H2,13,14,15,16,17);9-11H,3-8H2,1-2H3/t;9-/m.0/s1 |
| InChIKey | MJCBWPMBFCUHBP-NPULLEENSA-N |
| Boiling point | 508.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 139.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Barbexaclone |