Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2-Chloro-1-[3-(Trifluoromethyl)Phenyl]Ethanone |
|---|---|
| Synonyms | 2-Chloro-5-(trifluoromethyl)acetophenone; 3'-(Trifluoromethyl)phenacyl chloride; 3-TRIFLUOROMETHYLPHENACYLCHLORIDE |
| Molecular Structure | ![CAS#: 439807-20-2， 2-Chloro-1-[3-(Trifluoromethyl)Phenyl]Ethanone](/moreStructures/439807-20-2.gif) |
| Molecular Formula | C9H6ClF3O |
| Molecular Weight | 222.59 |
| CAS Registry Number | 439807-20-2 |
| SMILES | FC(F)(F)c1cc(ccc1)C(=O)CCl |
| InChI | 1S/C9H6ClF3O/c10-5-8(14)6-2-1-3-7(4-6)9(11,12)13/h1-4H,5H2 |
| InChIKey | CPEDVBNSZUDGFO-UHFFFAOYSA-N |
| Density | 1.342g/cm3 (Cal.) |
|---|---|
| Boiling point | 226.15°C at 760 mmHg (Cal.) |
| Flash point | 90.572°C (Cal.) |
| Refractive index | 1.468 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-1-[3-(Trifluoromethyl)Phenyl]Ethanone |