|
CAS#: 4405-28-1 Product: 2-(Dimethylamino)-5-Nitrobenzoic Acid No suppilers available for the product. |
| Name | 2-(Dimethylamino)-5-Nitrobenzoic Acid |
|---|---|
| Synonyms | 2-Dimethylamino-5-Nitro-Benzoate; Zinc03887939 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9N2O4 |
| Molecular Weight | 209.18 |
| CAS Registry Number | 4405-28-1 |
| SMILES | C1=CC(=CC(=C1N(C)C)C([O-])=O)[N+]([O-])=O |
| InChI | 1S/C9H10N2O4/c1-10(2)8-4-3-6(11(14)15)5-7(8)9(12)13/h3-5H,1-2H3,(H,12,13)/p-1 |
| InChIKey | DOWIJKGYCPKWNC-UHFFFAOYSA-M |
| Boiling point | 387.146°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 187.939°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Dimethylamino)-5-Nitrobenzoic Acid |