Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| CiVentiChem - Simple Solutions for Complex Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (919) 678-0702 | |||
|
sales@cvchem.com | |||
| Chemical manufacturer since 1994 | ||||
| Name | 4-Penten-1-Yl 6-O-[(2-Methyl-2-Propanyl)(Diphenyl)Silyl]-D-Glucopyranoside |
|---|---|
| Synonyms | Pent-4-enyl-6-O-t-butyldiphenylsilyl-D-Glucopyranoside |
| Molecular Structure | ![CAS#: 441311-03-1， 4-Penten-1-Yl 6-O-[(2-Methyl-2-Propanyl)(Diphenyl)Silyl]-D-Glucopyranoside](/moreStructures/441311-03-1.gif) |
| Molecular Formula | C27H38O6Si |
| Molecular Weight | 486.67 |
| CAS Registry Number | 441311-03-1 |
| SMILES | CC(C)(C)[Si](OC[C@H]1OC(OCCCC=C)[C@H](O)[C@@H](O)[C@@H]1O)(c2ccccc2)c3ccccc3 |
| InChI | 1S/C27H38O6Si/c1-5-6-13-18-31-26-25(30)24(29)23(28)22(33-26)19-32-34(27(2,3)4,20-14-9-7-10-15-20)21-16-11-8-12-17-21/h5,7-12,14-17,22-26,28-30H,1,6,13,18-19H2,2-4H3/t22-,23-,24+,25-,26?/m1/s1 |
| InChIKey | MPZDRGKKJAEYSG-XGHLBVCRSA-N |
| Density | 1.159g/cm3 (Cal.) |
|---|---|
| Boiling point | 570.607°C at 760 mmHg (Cal.) |
| Flash point | 298.893°C (Cal.) |
| Refractive index | 1.566 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Penten-1-Yl 6-O-[(2-Methyl-2-Propanyl)(Diphenyl)Silyl]-D-Glucopyranoside |