| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl 2-Amino-4-Heptynoate |
|---|---|
| Synonyms | InChI=1/C8H13NO2/c1-3-4-5-6-7(9)8(10)11-2/h7H,3,6,9H2,1-2H3; Methyl 2-aminohept-4-ynoate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.19 |
| CAS Registry Number | 441777-48-6 |
| SMILES | CCC#CCC(C(=O)OC)N |
| InChI | 1S/C8H13NO2/c1-3-4-5-6-7(9)8(10)11-2/h7H,3,6,9H2,1-2H3 |
| InChIKey | ITQNFRZMMSCCAR-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 229.9±30.0°C at 760 mmHg (Cal.) |
| Flash point | 96.8±22.1°C (Cal.) |
| Refractive index | 1.472 (Cal.) |
| (1) | David W. Knight, Adele L. Redfern and Jeremy Gilmore. An approach to 2,3-dihydropyrroles and ß-iodopyrroles based on 5-endo-dig cyclisations, J. Chem. Soc., Perkin Trans. 1, 2002, 0, 622. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Methyl 2-Amino-4-Heptynoate |