Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Sulfonfluorescein |
|---|---|
| Synonyms | 1,1-Diketospiro[Benzo[C]Oxathiole-3,9'-Xanthene]-3',6'-Diol; 1,1-Dioxospiro[Benzo[C][1,2]Oxathiole-3,9'-Xanthene]-3',6'-Diol; 2-19-00-00413 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C19H12O6S |
| Molecular Weight | 368.36 |
| CAS Registry Number | 4424-03-7 |
| EINECS | 224-596-9 |
| SMILES | C1=CC(=CC3=C1C5(C2=C(C=C(O)C=C2)O3)C4=CC=CC=C4[S](O5)(=O)=O)O |
| InChI | 1S/C19H12O6S/c20-11-5-7-13-16(9-11)24-17-10-12(21)6-8-14(17)19(13)15-3-1-2-4-18(15)26(22,23)25-19/h1-10,20-21H |
| InChIKey | VJYGFSGAAOVTLC-UHFFFAOYSA-N |
| Density | 1.725g/cm3 (Cal.) |
|---|---|
| Boiling point | 622.08°C at 760 mmHg (Cal.) |
| Flash point | 330.022°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Sulfonfluorescein |