Online Database of Chemicals from Around the World
|
CAS#: 443-76-5 Product: 2-Ethyleneimino-5,6,7,8-Tetrahydronaphthoquinone No suppilers available for the product. |
| Name | 2-Ethyleneimino-5,6,7,8-Tetrahydronaphthoquinone |
|---|---|
| Synonyms | 2-(1-Aziridinyl)-5,6,7,8-Tetrahydronaphthalene-1,4-Dione; 2-Ethylenimino-5,6,7,8-Tetrahydronaphthalene-1,4-Quinone; 1,4-Naphthoquinone, 2-(1-Aziridinyl)-5,6,7,8-Tetrahydro- |
| Molecular Structure |  |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 |
| CAS Registry Number | 443-76-5 |
| SMILES | O=C1C3=C(C(=O)C=C1N2CC2)CCCC3 |
| InChI | 1S/C12H13NO2/c14-11-7-10(13-5-6-13)12(15)9-4-2-1-3-8(9)11/h7H,1-6H2 |
| InChIKey | MWOHJANRPKUELV-UHFFFAOYSA-N |
| Density | 1.291g/cm3 (Cal.) |
|---|---|
| Boiling point | 351.339°C at 760 mmHg (Cal.) |
| Flash point | 161.658°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ethyleneimino-5,6,7,8-Tetrahydronaphthoquinone |