Online Database of Chemicals from Around the World
| Name | 3,6-Dihydroxy-5-Oxo-1,3,6-Cycloheptatriene-1-Carboxylic Acid |
|---|---|
| Synonyms | 5,6-Dihydroxy-3-Oxo-Cyclohepta-1,4,6-Triene-1-Carboxylic Acid; 5,6-Dihydroxy-3-Oxo-1-Cyclohepta-1,4,6-Trienecarboxylic Acid; 5,6-Dihydroxy-3-Keto-Cyclohepta-1,4,6-Triene-1-Carboxylic Acid |
| Molecular Structure |  |
| Molecular Formula | C8H6O5 |
| Molecular Weight | 182.13 |
| CAS Registry Number | 4440-39-5 |
| SMILES | O=C1C=C(C=C(O)C(=C1)O)C(O)=O |
| InChI | 1S/C8H6O5/c9-5-1-4(8(12)13)2-6(10)7(11)3-5/h1-3,10-11H,(H,12,13) |
| InChIKey | ZGKNMKBZOSTFCB-UHFFFAOYSA-N |
| Density | 1.807g/cm3 (Cal.) |
|---|---|
| Boiling point | 245.35°C at 760 mmHg (Cal.) |
| Flash point | 116.449°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,6-Dihydroxy-5-Oxo-1,3,6-Cycloheptatriene-1-Carboxylic Acid |
