| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl [(1R,3R,5S)-3-(Aminomethyl)Bicyclo[3.2.0]Hept-3-Yl]Acetate |
|---|---|
| Synonyms | methyl 2- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.27 |
| CAS Registry Number | 444088-20-4 |
| SMILES | COC(=O)C[C@@]1(C[C@H]2CC[C@H]2C1)CN |
| InChI | 1S/C11H19NO2/c1-14-10(13)6-11(7-12)4-8-2-3-9(8)5-11/h8-9H,2-7,12H2,1H3/t8-,9+,11+ |
| InChIKey | ASBDKEXHKWHAPE-JZYVYDRUSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 271.0±13.0°C at 760 mmHg (Cal.) |
| Flash point | 131.8±17.4°C (Cal.) |
| Refractive index | 1.495 (Cal.) |
| (1) | Ohashi Katsuyo, Kawai Mitsuhisa, Ninomiya Noriko, Taylor Charles, Kurebayashi Yoichi. Effect of a New α<sub>2</sub>δ Ligand PD-217014 on Visceral Hypersensitivity Induced by 2,4,6-Trinitrobenzene Sulfonic Acid in Rats, Pharmacology, 2008 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Methyl [(1R,3R,5S)-3-(Aminomethyl)Bicyclo[3.2.0]Hept-3-Yl]Acetate |