Online Database of Chemicals from Around the World
|
CAS#: 446-62-8 Product: 6,7-Dichloro-3,4-Dihydro-3-Methyl-2H-1,2,4-Benzothiadiazine 1,1-Dioxide No suppilers available for the product. |
| Name | 6,7-Dichloro-3,4-Dihydro-3-Methyl-2H-1,2,4-Benzothiadiazine 1,1-Dioxide |
|---|---|
| Synonyms | 2H-1,2,4-Benzothiadiazine, 3,4-Dihydro-6,7-Dichloro-3-Methyl-, 1,1-Dioxide; 3,4-Dihydro-6,7-Dichloro-3-Methyl-2H-1,2,4-Benzothiadiazine 1,1-Dioxide; 3,4-Diidro-6,7-Dicloro-3-Metil-2H-1,2,4-Benzotiodiazina 1,1-Diossido [Italian] |
| Molecular Structure |  |
| Molecular Formula | C8H8Cl2N2O2S |
| Molecular Weight | 267.13 |
| CAS Registry Number | 446-62-8 |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)NC(N[S]2(=O)=O)C |
| InChI | 1S/C8H8Cl2N2O2S/c1-4-11-7-2-5(9)6(10)3-8(7)15(13,14)12-4/h2-4,11-12H,1H3 |
| InChIKey | XKFWNSMNSIGNBO-UHFFFAOYSA-N |
| Density | 1.494g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.559°C at 760 mmHg (Cal.) |
| Flash point | 208.752°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7-Dichloro-3,4-Dihydro-3-Methyl-2H-1,2,4-Benzothiadiazine 1,1-Dioxide |