| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (3S,4R,5S)-3-Methylhexahydro-4,5-Pyridazinediol |
|---|---|
| Synonyms | (3S,4R,5S)-3-methylhexahydropyridazine-4,5-diol; (3S,4R,5S)-4,5-dihydroxy-3-methylhexahydropyridazine; InChI=1/C |
| Molecular Structure | ![]() |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 |
| CAS Registry Number | 449146-83-2 |
| SMILES | C[C@H]1[C@H]([C@H](CNN1)O)O |
| InChI | 1S/C5H12N2O2/c1-3-5(9)4(8)2-6-7-3/h3-9H,2H2,1H3/t3-,4-,5+/m0/s1 |
| InChIKey | SFWAQASNOSFXTF-VAYJURFESA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 224.3±40.0°C at 760 mmHg (Cal.) |
| Flash point | 111.0±17.9°C (Cal.) |
| Refractive index | 1.499 (Cal.) |
| (1) | Henrik H. Jensen, Astrid Jensen, Rita G. Hazell and Mikael Bols. Synthesis and investigation of L-fuco- and D-glucurono-azafagomine, J. Chem. Soc., Perkin Trans. 1, 2002, 0, 1190. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (3S,4R,5S)-3-Methylhexahydro-4,5-Pyridazinediol |