Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-(4-Ethylphenyl)-1-Isopropylurea |
|---|---|
| Synonyms | 1-(4-ethylphenyl)-1-isopropylurea; 1-(p-Ethylphenyl)-1-isopropylurea; Isopropyl-p-ethylphenylurea |
| Molecular Structure |  |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.28 |
| CAS Registry Number | 449789-96-2 |
| SMILES | O=C(N(c1ccc(cc1)CC)C(C)C)N |
| InChI | 1S/C12H18N2O/c1-4-10-5-7-11(8-6-10)14(9(2)3)12(13)15/h5-9H,4H2,1-3H3,(H2,13,15) |
| InChIKey | KPNFVWKCZHSNMA-UHFFFAOYSA-N |
| Density | 1.061g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.618°C at 760 mmHg (Cal.) |
| Flash point | 152.543°C (Cal.) |
| Refractive index | 1.56 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Ethylphenyl)-1-Isopropylurea |