|
CAS#: 4514-54-9 Product: 6-(3-Chlorophenyl)-1,3,5-Triazine-2,4-Diamine No suppilers available for the product. |
| Name | 6-(3-Chlorophenyl)-1,3,5-Triazine-2,4-Diamine |
|---|---|
| Synonyms | [4-Amino-6-(3-Chlorophenyl)-S-Triazin-2-Yl]Amine; Nsc210911 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8ClN5 |
| Molecular Weight | 221.65 |
| CAS Registry Number | 4514-54-9 |
| SMILES | C1=C(Cl)C=CC=C1C2=NC(=NC(=N2)N)N |
| InChI | 1S/C9H8ClN5/c10-6-3-1-2-5(4-6)7-13-8(11)15-9(12)14-7/h1-4H,(H4,11,12,13,14,15) |
| InChIKey | QBLXLPLVBAYDMX-UHFFFAOYSA-N |
| Density | 1.469g/cm3 (Cal.) |
|---|---|
| Boiling point | 530.08°C at 760 mmHg (Cal.) |
| Flash point | 274.383°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(3-Chlorophenyl)-1,3,5-Triazine-2,4-Diamine |