Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-Phenoxy-4(1H)-Pyridinone |
|---|---|
| Synonyms | 1-phenoxypyridin-4(1H)-one; 4(1H)-Pyridinone,1-phenoxy- |
| Molecular Structure |  |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.19 |
| CAS Registry Number | 452314-03-3 |
| SMILES | O=C\2\C=C/N(Oc1ccccc1)/C=C/2 |
| InChI | 1S/C11H9NO2/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-9H |
| InChIKey | IPDAEUMJYVIVEX-UHFFFAOYSA-N |
| Density | 1.247g/cm3 (Cal.) |
|---|---|
| Boiling point | 274.633°C at 760 mmHg (Cal.) |
| Flash point | 119.894°C (Cal.) |
| Refractive index | 1.613 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Phenoxy-4(1H)-Pyridinone |