Online Database of Chemicals from Around the World
|
CAS#: 4539-51-9 Product: 2-Aminocarbazole No suppilers available for the product. |
| Name | 2-Aminocarbazole |
|---|---|
| Synonyms | 9H-Carbazol-2-Ylamine; 2-Aminocarbazole; 9H-Carbazol-2-Amine (9Ci) |
| Molecular Structure |  |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.22 |
| CAS Registry Number | 4539-51-9 |
| SMILES | C1=CC2=C(C=C1N)[NH]C3=CC=CC=C23 |
| InChI | 1S/C12H10N2/c13-8-5-6-10-9-3-1-2-4-11(9)14-12(10)7-8/h1-7,14H,13H2 |
| InChIKey | IGLKULAEHPBIJL-UHFFFAOYSA-N |
| Density | 1.318g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.75°C at 760 mmHg (Cal.) |
| Flash point | 250.565°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Aminocarbazole |