Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 4-Ethylbenzenesulphonyl Fluoride |
|---|---|
| Synonyms | Benzenesulfonyl Fluoride, 4-Ethyl-; P-Ethylbenzenesulphonyl Fluoride |
| Molecular Structure |  |
| Molecular Formula | C8H9FO2S |
| Molecular Weight | 188.22 |
| CAS Registry Number | 455-20-9 |
| EINECS | 207-241-2 |
| SMILES | C1=CC(=CC=C1[S](F)(=O)=O)CC |
| InChI | 1S/C8H9FO2S/c1-2-7-3-5-8(6-4-7)12(9,10)11/h3-6H,2H2,1H3 |
| InChIKey | YKTVOVMXBLLWNM-UHFFFAOYSA-N |
| Density | 1.23g/cm3 (Cal.) |
|---|---|
| Boiling point | 236.249°C at 760 mmHg (Cal.) |
| Flash point | 96.68°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Ethylbenzenesulphonyl Fluoride |