|
CAS#: 4572-51-4 Product: N-Phenyl-N-(2,4,4-Trimethyl-2-Pentanyl)-1-Naphthalenamine No suppilers available for the product. |
| Name | N-Phenyl-N-(2,4,4-Trimethyl-2-Pentanyl)-1-Naphthalenamine |
|---|---|
| Synonyms | N-((1,1,3,3-TETRAMETHYLBUTYL)PHENYL)-1-NAPHTHA*; tert-Octylphenyl-α-naphthylamine |
| Molecular Structure | ![]() |
| Molecular Formula | C24H29N |
| Molecular Weight | 331.49 |
| CAS Registry Number | 4572-51-4 |
| SMILES | N(c2c1ccccc1ccc2)(c3ccccc3)C(CC(C)(C)C)(C)C |
| InChI | 1S/C24H29N/c1-23(2,3)18-24(4,5)25(20-14-7-6-8-15-20)22-17-11-13-19-12-9-10-16-21(19)22/h6-17H,18H2,1-5H3 |
| InChIKey | SNWVRVDHQRBBFG-UHFFFAOYSA-N |
| Density | 1.024g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.531°C at 760 mmHg (Cal.) |
| Flash point | 202.318°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Phenyl-N-(2,4,4-Trimethyl-2-Pentanyl)-1-Naphthalenamine |