Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-[(2S)-2-Oxiranylmethoxy]Aniline |
|---|---|
| Synonyms | (S)-3-(oxiran-2-ylmethoxy)aniline |
| Molecular Structure | ![CAS#: 457898-09-8， 3-[(2S)-2-Oxiranylmethoxy]Aniline](/moreStructures/457898-09-8.gif) |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 |
| CAS Registry Number | 457898-09-8 |
| SMILES | c1cc(cc(c1)OC[C@@H]2CO2)N |
| InChI | 1S/C9H11NO2/c10-7-2-1-3-8(4-7)11-5-9-6-12-9/h1-4,9H,5-6,10H2/t9-/m1/s1 |
| InChIKey | BZIKFXDSIMRAIL-SECBINFHSA-N |
| Density | 1.214g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.075°C at 760 mmHg (Cal.) |
| Flash point | 164.535°C (Cal.) |
| Refractive index | 1.592 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[(2S)-2-Oxiranylmethoxy]Aniline |