Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Endomide |
|---|---|
| Synonyms | (1R,2S,3S,4S)-N,N,N',N'-Tetraethyl-5-Norbornene-2,3-Dicarboxamide; 5-Norbornene-2,3-Dicarboxamide, N,N,N',N'-Tetraethyl-, Trans-; Bicyclo(2.2.1)Hept-5-Ene-2,3-Dicarboxamide, N,N,N',N'-Tetraethyl-, (1R-(2-Endo,3-Exo))- |
| Molecular Structure |  |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 |
| CAS Registry Number | 4582-18-7 |
| EINECS | 224-965-4 |
| SMILES | [C@@H]1([C@@H]([C@H]2C=C[C@@H]1C2)C(N(CC)CC)=O)C(N(CC)CC)=O |
| InChI | 1S/C17H28N2O2/c1-5-18(6-2)16(20)14-12-9-10-13(11-12)15(14)17(21)19(7-3)8-4/h9-10,12-15H,5-8,11H2,1-4H3/t12-,13+,14-,15-/m1/s1 |
| InChIKey | BXAMVNHBXFXFSK-LXTVHRRPSA-N |
| Density | 1.065g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.354°C at 760 mmHg (Cal.) |
| Flash point | 185.177°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Endomide |