Online Database of Chemicals from Around the World
| Exclusive Chemistry Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
 |
+7 (903) 713-5556 | |||
 |
info@exchemistry.com | |||
| Chemical manufacturer | ||||
| Name | 3-Chloroisoquinoline 2-Oxide |
|---|---|
| Synonyms | 3-Chloroisoquinoline 2-Oxide |
| Molecular Structure |  |
| Molecular Formula | C9H6ClNO |
| Molecular Weight | 179.61 |
| CAS Registry Number | 46038-05-5 |
| SMILES | C1=C(Cl)[N+](=CC2=CC=CC=C12)[O-] |
| InChI | 1S/C9H6ClNO/c10-9-5-7-3-1-2-4-8(7)6-11(9)12/h1-6H |
| InChIKey | IAZNEBKJQPVSHO-UHFFFAOYSA-N |
| Density | 1.304g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.47°C at 760 mmHg (Cal.) |
| Flash point | 208.093°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloroisoquinoline 2-Oxide |