Online Database of Chemicals from Around the World
|
CAS#: 461-08-5 Product: Heliotropyl Iso-Butyrate No suppilers available for the product. |
| Name | Heliotropyl Iso-Butyrate |
|---|---|
| Synonyms | Bis(Trifluoromethylthio)Methanethione; Carbonotrithioic Acid, Bis(Trifluoromethyl) Ester; Carbonic Acid, Trithio-, Bis(Trifluoromethyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C3F6S3 |
| Molecular Weight | 246.20 |
| CAS Registry Number | 461-08-5 |
| SMILES | C(SC(F)(F)F)(SC(F)(F)F)=S |
| InChI | 1S/C3F6S3/c4-2(5,6)11-1(10)12-3(7,8)9 |
| InChIKey | BHLMOIFXVOEGPU-UHFFFAOYSA-N |
| Density | 1.713g/cm3 (Cal.) |
|---|---|
| Boiling point | 87.369°C at 760 mmHg (Cal.) |
| Flash point | 6.641°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Heliotropyl Iso-Butyrate |