Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 5-(Aminomethyl)-5,6,7,8-Tetrahydro-1,2,5-Naphthalenetriol |
|---|---|
| Synonyms | 5-(aminomethyl)-5,6,7,8-tetrahydronaphthalene-1,2,5-triol |
| Molecular Structure |  |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 |
| CAS Registry Number | 462100-26-1 |
| SMILES | c1cc(c(c2c1C(CCC2)(CN)O)O)O |
| InChI | 1S/C11H15NO3/c12-6-11(15)5-1-2-7-8(11)3-4-9(13)10(7)14/h3-4,13-15H,1-2,5-6,12H2 |
| InChIKey | BPZBYDMVSAQLHO-UHFFFAOYSA-N |
| Density | 1.365g/cm3 (Cal.) |
|---|---|
| Boiling point | 434.996°C at 760 mmHg (Cal.) |
| Flash point | 216.878°C (Cal.) |
| Refractive index | 1.659 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(Aminomethyl)-5,6,7,8-Tetrahydro-1,2,5-Naphthalenetriol |