Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N-Phenylimidodicarbonic acid |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.15 |
| CAS Registry Number | 462126-93-8 |
| SMILES | c1ccc(cc1)N(C(=O)O)C(=O)O |
| InChI | 1S/C8H7NO4/c10-7(11)9(8(12)13)6-4-2-1-3-5-6/h1-5H,(H,10,11)(H,12,13) |
| InChIKey | QKYHAGLNCAABEZ-UHFFFAOYSA-N |
| Density | 1.553g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.669°C at 760 mmHg (Cal.) |
| Flash point | 189.466°C (Cal.) |
| Refractive index | 1.672 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Phenylimidodicarbonic acid |