Online Database of Chemicals from Around the World
|
CAS#: 46382-84-7 Product: 1,3-Dimethyl-5H-Pyrido(4,3-b)Indole No suppilers available for the product. |
| Name | 1,3-Dimethyl-5H-Pyrido(4,3-b)Indole |
|---|---|
| Synonyms | 5H-Pyrido(4,3-B)Indole, 1,3-Dimethyl-; Zinc00970099; 1,3-Dimethyl-5H-Pyrido(4,3-B)Indole |
| Molecular Structure |  |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 |
| CAS Registry Number | 46382-84-7 |
| SMILES | C1=CC=CC2=C1[NH]C3=C2C(=NC(=C3)C)C |
| InChI | 1S/C13H12N2/c1-8-7-12-13(9(2)14-8)10-5-3-4-6-11(10)15-12/h3-7,15H,1-2H3 |
| InChIKey | LSMFRNHNKRLJLH-UHFFFAOYSA-N |
| Density | 1.213g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.898°C at 760 mmHg (Cal.) |
| Flash point | 172.416°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dimethyl-5H-Pyrido(4,3-b)Indole |